C15H14N2OS — CID 134094787
N-phenyl-2,3-dihydro-1,4-benzoxazine-4-carbothioamide (PubChem CID 134094787) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is N-phenyl-2,3-dihydro-1,4-benzoxazine-4-carbothioamide.
| Compound Name | N-phenyl-2,3-dihydro-1,4-benzoxazine-4-carbothioamide |
|---|---|
| PubChem CID | 134094787 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-phenyl-2,3-dihydro-1,4-benzoxazine-4-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1CCOc2ccccc21 |
| InChI | InChI=1S/C15H14N2OS/c19-15(16-12-6-2-1-3-7-12)17-10-11-18-14-9-5-4-8-13(14)17/h1-9H,10-11H2,(H,16,19) |
| InChIKey | OKQDYWWUWWNJFS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|