C17H18N2O4 — CID 22521341
N-(3,4-dimethoxyphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide (PubChem CID 22521341) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
|---|---|
| PubChem CID | 22521341 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCOc3ccccc32)cc1OC |
| InChI | InChI=1S/C17H18N2O4/c1-21-15-8-7-12(11-16(15)22-2)18-17(20)19-9-10-23-14-6-4-3-5-13(14)19/h3-8,11H,9-10H2,1-2H3,(H,18,20) |
| InChIKey | KJURZBIHNNOMAP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |