C11H10N2O — CID 83752827
2-(2,3-dihydro-1,4-benzoxazin-4-yl)prop-2-enenitrile (PubChem CID 83752827) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzoxazin-4-yl)prop-2-enenitrile.
| Compound Name | 2-(2,3-dihydro-1,4-benzoxazin-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 83752827 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzoxazin-4-yl)prop-2-enenitrile |
| SMILES | C=C(C#N)N1CCOc2ccccc21 |
| InChI | InChI=1S/C11H10N2O/c1-9(8-12)13-6-7-14-11-5-3-2-4-10(11)13/h2-5H,1,6-7H2 |
| InChIKey | ZOIRAQNVZXAPJD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|