C13H17N3S — CID 116508695
N-cyclopropyl-4-methyl-2,3-dihydroquinoxaline-1-carbothioamide (PubChem CID 116508695) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-2,3-dihydroquinoxaline-1-carbothioamide.
| Compound Name | N-cyclopropyl-4-methyl-2,3-dihydroquinoxaline-1-carbothioamide |
|---|---|
| PubChem CID | 116508695 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-cyclopropyl-4-methyl-2,3-dihydroquinoxaline-1-carbothioamide |
| SMILES | CN1CCN(C(=S)NC2CC2)c2ccccc21 |
| InChI | InChI=1S/C13H17N3S/c1-15-8-9-16(13(17)14-10-6-7-10)12-5-3-2-4-11(12)15/h2-5,10H,6-9H2,1H3,(H,14,17) |
| InChIKey | XHMCAJBHWKIOFG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|