C14H18N2S — CID 19686662
N-cyclopentyl-2,3-dihydroindole-1-carbothioamide (PubChem CID 19686662) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is N-cyclopentyl-2,3-dihydroindole-1-carbothioamide.
| Compound Name | N-cyclopentyl-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 19686662 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-cyclopentyl-2,3-dihydroindole-1-carbothioamide |
| SMILES | S=C(NC1CCCC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C14H18N2S/c17-14(15-12-6-2-3-7-12)16-10-9-11-5-1-4-8-13(11)16/h1,4-5,8,12H,2-3,6-7,9-10H2,(H,15,17) |
| InChIKey | XGRNAMLRIBJTFS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|