C24H29N3O2 — CID 92881765
1-cyclohexyl-3-[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxo-3-phenylpropan-2-yl]urea (PubChem CID 92881765) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxo-3-phenylpropan-2-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxo-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 92881765 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 1-cyclohexyl-3-[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxo-3-phenylpropan-2-yl]urea |
| SMILES | O=C(NC1CCCCC1)N[C@H](Cc1ccccc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H29N3O2/c28-23(27-16-15-19-11-7-8-14-22(19)27)21(17-18-9-3-1-4-10-18)26-24(29)25-20-12-5-2-6-13-20/h1,3-4,7-11,14,20-21H,2,5-6,12-13,15-17H2,(H2,25,26,29)/t21-/m1/s1 |
| InChIKey | UEYQWRVZSCNFQL-OAQYLSRUSA-N |
| XLogP | 3.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |