C25H26N2O6 — CID 101195071
ethyl 4-benzyl-2-(2-ethoxy-2-oxoethyl)-8-formyl-3,6-dihydro-2H-pyrrolo[2,3-g][1,4]benzoxazine-7-carboxylate (PubChem CID 101195071) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is ethyl 4-benzyl-2-(2-ethoxy-2-oxoethyl)-8-formyl-3,6-dihydro-2H-pyrrolo[2,3-g][1,4]benzoxazine-7-carboxylate.
| Compound Name | ethyl 4-benzyl-2-(2-ethoxy-2-oxoethyl)-8-formyl-3,6-dihydro-2H-pyrrolo[2,3-g][1,4]benzoxazine-7-carboxylate |
|---|---|
| PubChem CID | 101195071 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | ethyl 4-benzyl-2-(2-ethoxy-2-oxoethyl)-8-formyl-3,6-dihydro-2H-pyrrolo[2,3-g][1,4]benzoxazine-7-carboxylate |
| SMILES | CCOC(=O)CC1CN(Cc2ccccc2)c2cc3[nH]c(C(=O)OCC)c(C=O)c3cc2O1 |
| InChI | InChI=1S/C25H26N2O6/c1-3-31-23(29)10-17-14-27(13-16-8-6-5-7-9-16)21-12-20-18(11-22(21)33-17)19(15-28)24(26-20)25(30)32-4-2/h5-9,11-12,15,17,26H,3-4,10,13-14H2,1-2H3 |
| InChIKey | HMPZCDVQPNIHGQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 97.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|