C20H21NO5 — CID 30372759
2-(4-methylphenoxy)ethyl (2S)-4-acetyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate (PubChem CID 30372759) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl (2S)-4-acetyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate.
| Compound Name | 2-(4-methylphenoxy)ethyl (2S)-4-acetyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 30372759 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl (2S)-4-acetyl-2,3-dihydro-1,4-benzoxazine-2-carboxylate |
| SMILES | CC(=O)N1C[C@@H](C(=O)OCCOc2ccc(C)cc2)Oc2ccccc21 |
| InChI | InChI=1S/C20H21NO5/c1-14-7-9-16(10-8-14)24-11-12-25-20(23)19-13-21(15(2)22)17-5-3-4-6-18(17)26-19/h3-10,19H,11-13H2,1-2H3/t19-/m0/s1 |
| InChIKey | INZODUVJUUSXCX-IBGZPJMESA-N |
| XLogP | 2.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|