C17H14FNO4 — CID 16581507
(4-fluorophenyl) 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 16581507) has the molecular formula C17H14FNO4 and a molecular weight of 315.30 g/mol. Its IUPAC name is (4-fluorophenyl) 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | (4-fluorophenyl) 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 16581507 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (4-fluorophenyl) 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | CC1Oc2ccccc2N(CC(=O)Oc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H14FNO4/c1-11-17(21)19(14-4-2-3-5-15(14)22-11)10-16(20)23-13-8-6-12(18)7-9-13/h2-9,11H,10H2,1H3 |
| InChIKey | LSINSKKGRKDCHO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|