C18H15N5O4 — CID 16581622
[4-(tetrazol-1-yl)phenyl] 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 16581622) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is [4-(tetrazol-1-yl)phenyl] 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | [4-(tetrazol-1-yl)phenyl] 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 16581622 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [4-(tetrazol-1-yl)phenyl] 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | CC1Oc2ccccc2N(CC(=O)Oc2ccc(-n3cnnn3)cc2)C1=O |
| InChI | InChI=1S/C18H15N5O4/c1-12-18(25)22(15-4-2-3-5-16(15)26-12)10-17(24)27-14-8-6-13(7-9-14)23-11-19-20-21-23/h2-9,11-12H,10H2,1H3 |
| InChIKey | MKAURWMQCHSFLO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|