C19H16N4O5 — CID 55341048
[4-(tetrazol-1-yl)phenyl] 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoate (PubChem CID 55341048) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is [4-(tetrazol-1-yl)phenyl] 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoate.
| Compound Name | [4-(tetrazol-1-yl)phenyl] 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55341048 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [4-(tetrazol-1-yl)phenyl] 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)OCCO2)Oc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C19H16N4O5/c24-16(13-1-7-17-18(11-13)27-10-9-26-17)6-8-19(25)28-15-4-2-14(3-5-15)23-12-20-21-22-23/h1-5,7,11-12H,6,8-10H2 |
| InChIKey | LKUDYXGKUQPXBP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|