C24H18N2O4 — CID 24585782
[4-(4-cyanophenyl)phenyl] 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 24585782) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 24585782 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | CC1Oc2ccccc2N(CC(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)C1=O |
| InChI | InChI=1S/C24H18N2O4/c1-16-24(28)26(21-4-2-3-5-22(21)29-16)15-23(27)30-20-12-10-19(11-13-20)18-8-6-17(14-25)7-9-18/h2-13,16H,15H2,1H3 |
| InChIKey | RORSMSRHVMNTIL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|