C20H21NO4 — CID 24585860
(2,3,6-trimethylphenyl) 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 24585860) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | (2,3,6-trimethylphenyl) 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 24585860 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (2,3,6-trimethylphenyl) 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | Cc1ccc(C)c(OC(=O)CN2C(=O)C(C)Oc3ccccc32)c1C |
| InChI | InChI=1S/C20H21NO4/c1-12-9-10-13(2)19(14(12)3)25-18(22)11-21-16-7-5-6-8-17(16)24-15(4)20(21)23/h5-10,15H,11H2,1-4H3 |
| InChIKey | VKHMLDFHKWLXDH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|