C17H21NO4 — CID 30092379
cyclohexyl 2-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]acetate (PubChem CID 30092379) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is cyclohexyl 2-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]acetate.
| Compound Name | cyclohexyl 2-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
|---|---|
| PubChem CID | 30092379 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | cyclohexyl 2-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
| SMILES | C[C@H]1Oc2ccccc2N(CC(=O)OC2CCCCC2)C1=O |
| InChI | InChI=1S/C17H21NO4/c1-12-17(20)18(14-9-5-6-10-15(14)21-12)11-16(19)22-13-7-3-2-4-8-13/h5-6,9-10,12-13H,2-4,7-8,11H2,1H3/t12-/m1/s1 |
| InChIKey | CGPVPEFFZZHGDS-GFCCVEGCSA-N |
| XLogP | 2.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |