C11H13N3O3 — CID 28520009
2-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide (PubChem CID 28520009) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide.
| Compound Name | 2-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 28520009 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[(2R)-2-methyl-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide |
| SMILES | C[C@H]1Oc2ccccc2N(CC(=O)NN)C1=O |
| InChI | InChI=1S/C11H13N3O3/c1-7-11(16)14(6-10(15)13-12)8-4-2-3-5-9(8)17-7/h2-5,7H,6,12H2,1H3,(H,13,15)/t7-/m1/s1 |
| InChIKey | OKVANBJGPODAQP-SSDOTTSWSA-N |
| XLogP | -0.21 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|