C18H17N3O4 — CID 23409985
2-[[2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]benzamide (PubChem CID 23409985) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[[2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]benzamide.
| Compound Name | 2-[[2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 23409985 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[[2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]benzamide |
| SMILES | CC1Oc2ccccc2N(CC(=O)Nc2ccccc2C(N)=O)C1=O |
| InChI | InChI=1S/C18H17N3O4/c1-11-18(24)21(14-8-4-5-9-15(14)25-11)10-16(22)20-13-7-3-2-6-12(13)17(19)23/h2-9,11H,10H2,1H3,(H2,19,23)(H,20,22) |
| InChIKey | VWBXYXOUYKVMPR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |