C18H16N2O5 — CID 23409297
4-[[2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid (PubChem CID 23409297) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-[[2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23409297 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[[2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid |
| SMILES | CC1Oc2ccccc2N(CC(=O)Nc2ccc(C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C18H16N2O5/c1-11-17(22)20(14-4-2-3-5-15(14)25-11)10-16(21)19-13-8-6-12(7-9-13)18(23)24/h2-9,11H,10H2,1H3,(H,19,21)(H,23,24) |
| InChIKey | PKYNTULYPJPFPN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |