C25H16F2N2O4S — CID 3505300
3-(2,4-difluorophenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 3505300) has the molecular formula C25H16F2N2O4S and a molecular weight of 478.48 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(2,4-difluorophenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 3505300 |
| Molecular Formula | C25H16F2N2O4S |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 3-(2,4-difluorophenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | COc1ccc2c(CSc3nc4ccccc4c(=O)n3-c3ccc(F)cc3F)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H16F2N2O4S/c1-32-16-7-8-17-14(10-23(30)33-22(17)12-16)13-34-25-28-20-5-3-2-4-18(20)24(31)29(25)21-9-6-15(26)11-19(21)27/h2-12H,13H2,1H3 |
| InChIKey | XUXJVGBDZWPHFO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|