C25H16ClF2N3OS — CID 2494654
2-[(2-chloro-7-methylquinolin-3-yl)methylsulfanyl]-3-(2,4-difluorophenyl)quinazolin-4-one (PubChem CID 2494654) has the molecular formula C25H16ClF2N3OS and a molecular weight of 479.94 g/mol. Its IUPAC name is 2-[(2-chloro-7-methylquinolin-3-yl)methylsulfanyl]-3-(2,4-difluorophenyl)quinazolin-4-one.
| Compound Name | 2-[(2-chloro-7-methylquinolin-3-yl)methylsulfanyl]-3-(2,4-difluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2494654 |
| Molecular Formula | C25H16ClF2N3OS |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 2-[(2-chloro-7-methylquinolin-3-yl)methylsulfanyl]-3-(2,4-difluorophenyl)quinazolin-4-one |
| SMILES | Cc1ccc2cc(CSc3nc4ccccc4c(=O)n3-c3ccc(F)cc3F)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H16ClF2N3OS/c1-14-6-7-15-11-16(23(26)29-21(15)10-14)13-33-25-30-20-5-3-2-4-18(20)24(32)31(25)22-9-8-17(27)12-19(22)28/h2-12H,13H2,1H3 |
| InChIKey | HEAGZOXTKYCCBE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|