C26H18FN3O4S — CID 16532498
N-[4-[[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide (PubChem CID 16532498) has the molecular formula C26H18FN3O4S and a molecular weight of 487.51 g/mol. Its IUPAC name is N-[4-[[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide.
| Compound Name | N-[4-[[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide |
|---|---|
| PubChem CID | 16532498 |
| Molecular Formula | C26H18FN3O4S |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-[4-[[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(CSc3nc4ccccc4c(=O)n3-c3ccccc3F)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H18FN3O4S/c1-15(31)28-17-10-11-18-16(12-24(32)34-23(18)13-17)14-35-26-29-21-8-4-2-6-19(21)25(33)30(26)22-9-5-3-7-20(22)27/h2-13H,14H2,1H3,(H,28,31) |
| InChIKey | UEWAIJYFGHRSMZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|