C22H18FN3O5S — CID 42902759
N-[4-[[5-[1-(2-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide (PubChem CID 42902759) has the molecular formula C22H18FN3O5S and a molecular weight of 455.47 g/mol. Its IUPAC name is N-[4-[[5-[1-(2-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide.
| Compound Name | N-[4-[[5-[1-(2-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide |
|---|---|
| PubChem CID | 42902759 |
| Molecular Formula | C22H18FN3O5S |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-[4-[[5-[1-(2-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(CSc3nnc(C(C)Oc4ccccc4F)o3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H18FN3O5S/c1-12(29-18-6-4-3-5-17(18)23)21-25-26-22(31-21)32-11-14-9-20(28)30-19-10-15(24-13(2)27)7-8-16(14)19/h3-10,12H,11H2,1-2H3,(H,24,27) |
| InChIKey | IOUNBYJOTZGAGP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|