C16H13Cl2N5O3S — CID 46786619
3-(2,4-dichlorophenyl)-5-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 46786619) has the molecular formula C16H13Cl2N5O3S and a molecular weight of 426.29 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-5-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-(2,4-dichlorophenyl)-5-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 46786619 |
| Molecular Formula | C16H13Cl2N5O3S |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-5-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | COc1ccc([N+](=O)[O-])cc1CSc1nnc(-c2ccc(Cl)cc2Cl)n1N |
| InChI | InChI=1S/C16H13Cl2N5O3S/c1-26-14-5-3-11(23(24)25)6-9(14)8-27-16-21-20-15(22(16)19)12-4-2-10(17)7-13(12)18/h2-7H,8,19H2,1H3 |
| InChIKey | YWUYJLNKKSPLER-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|