C13H13BrFN3S — CID 60593744
3-[(5-bromo-2-fluorophenyl)methylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole (PubChem CID 60593744) has the molecular formula C13H13BrFN3S and a molecular weight of 342.24 g/mol. Its IUPAC name is 3-[(5-bromo-2-fluorophenyl)methylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(5-bromo-2-fluorophenyl)methylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 60593744 |
| Molecular Formula | C13H13BrFN3S |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 3-[(5-bromo-2-fluorophenyl)methylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(C)nnc1SCc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H13BrFN3S/c1-3-6-18-9(2)16-17-13(18)19-8-10-7-11(14)4-5-12(10)15/h3-5,7H,1,6,8H2,2H3 |
| InChIKey | BUYBUEKRMNPMJM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|