C14H15F2N3S — CID 60541194
3-[1-(2,5-difluorophenyl)ethylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole (PubChem CID 60541194) has the molecular formula C14H15F2N3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-[1-(2,5-difluorophenyl)ethylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[1-(2,5-difluorophenyl)ethylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 60541194 |
| Molecular Formula | C14H15F2N3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-[1-(2,5-difluorophenyl)ethylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(C)nnc1SC(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H15F2N3S/c1-4-7-19-10(3)17-18-14(19)20-9(2)12-8-11(15)5-6-13(12)16/h4-6,8-9H,1,7H2,2-3H3 |
| InChIKey | JRCUYFXVETVVSU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|