C16H17F2N3S — CID 60541222
3-cyclopropyl-5-[1-(2,5-difluorophenyl)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 60541222) has the molecular formula C16H17F2N3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-cyclopropyl-5-[1-(2,5-difluorophenyl)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-cyclopropyl-5-[1-(2,5-difluorophenyl)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 60541222 |
| Molecular Formula | C16H17F2N3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-cyclopropyl-5-[1-(2,5-difluorophenyl)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SC(C)c2cc(F)ccc2F)nnc1C1CC1 |
| InChI | InChI=1S/C16H17F2N3S/c1-3-8-21-15(11-4-5-11)19-20-16(21)22-10(2)13-9-12(17)6-7-14(13)18/h3,6-7,9-11H,1,4-5,8H2,2H3 |
| InChIKey | KRPMAYKCFYRGGL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|