C17H20FN3OS — CID 111629920
2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluoro-2-methylphenyl)ethanol (PubChem CID 111629920) has the molecular formula C17H20FN3OS and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluoro-2-methylphenyl)ethanol.
| Compound Name | 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 111629920 |
| Molecular Formula | C17H20FN3OS |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluoro-2-methylphenyl)ethanol |
| SMILES | C=CCn1c(SCC(O)c2ccc(F)cc2C)nnc1C1CC1 |
| InChI | InChI=1S/C17H20FN3OS/c1-3-8-21-16(12-4-5-12)19-20-17(21)23-10-15(22)14-7-6-13(18)9-11(14)2/h3,6-7,9,12,15,22H,1,4-5,8,10H2,2H3 |
| InChIKey | CQQRHDGAZRKKEA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|