C13H17FN4OS — CID 111629939
1-(4-fluoro-2-methylphenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylethanol (PubChem CID 111629939) has the molecular formula C13H17FN4OS and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylethanol.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylethanol |
|---|---|
| PubChem CID | 111629939 |
| Molecular Formula | C13H17FN4OS |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylethanol |
| SMILES | Cc1cc(F)ccc1C(O)CSc1nnnn1C(C)C |
| InChI | InChI=1S/C13H17FN4OS/c1-8(2)18-13(15-16-17-18)20-7-12(19)11-5-4-10(14)6-9(11)3/h4-6,8,12,19H,7H2,1-3H3 |
| InChIKey | VAZZSVYHAQWRIO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |