C16H18ClN3OS — CID 110884781
1-(4-chlorophenyl)-2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethanol (PubChem CID 110884781) has the molecular formula C16H18ClN3OS and a molecular weight of 335.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethanol.
| Compound Name | 1-(4-chlorophenyl)-2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethanol |
|---|---|
| PubChem CID | 110884781 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethanol |
| SMILES | C=CCn1c(SCC(O)c2ccc(Cl)cc2)nnc1C1CC1 |
| InChI | InChI=1S/C16H18ClN3OS/c1-2-9-20-15(12-3-4-12)18-19-16(20)22-10-14(21)11-5-7-13(17)8-6-11/h2,5-8,12,14,21H,1,3-4,9-10H2 |
| InChIKey | YHQZOMNRLFIAMO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|