C16H15N3O4S — CID 18202064
4-cyclopropyl-3-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one (PubChem CID 18202064) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is 4-cyclopropyl-3-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-cyclopropyl-3-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 18202064 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-cyclopropyl-3-[(7-methoxy-2-oxochromen-4-yl)methylsulfanyl]-1H-1,2,4-triazol-5-one |
| SMILES | COc1ccc2c(CSc3n[nH]c(=O)n3C3CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C16H15N3O4S/c1-22-11-4-5-12-9(6-14(20)23-13(12)7-11)8-24-16-18-17-15(21)19(16)10-2-3-10/h4-7,10H,2-3,8H2,1H3,(H,17,21) |
| InChIKey | JBMAZLIEXGTANQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|