C13H13N5O6S2 — CID 4836513
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetate (PubChem CID 4836513) has the molecular formula C13H13N5O6S2 and a molecular weight of 399.41 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 4836513 |
| Molecular Formula | C13H13N5O6S2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]acetate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)CSc1nnc(N)s1 |
| InChI | InChI=1S/C13H13N5O6S2/c1-23-9-4-7(18(21)22)2-3-8(9)15-10(19)5-24-11(20)6-25-13-17-16-12(14)26-13/h2-4H,5-6H2,1H3,(H2,14,16)(H,15,19) |
| InChIKey | QCAGWUWPWBZCGZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|