C9H10N6OS2 — CID 106909660
6-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]pyridine-2-carbohydrazide (PubChem CID 106909660) has the molecular formula C9H10N6OS2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 6-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]pyridine-2-carbohydrazide.
| Compound Name | 6-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 106909660 |
| Molecular Formula | C9H10N6OS2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 6-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1cccc(CSc2nnc(N)s2)n1 |
| InChI | InChI=1S/C9H10N6OS2/c10-8-14-15-9(18-8)17-4-5-2-1-3-6(12-5)7(16)13-11/h1-3H,4,11H2,(H2,10,14)(H,13,16) |
| InChIKey | WXBXUDUAYDWSTK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|