C12H17N7OS — CID 106909643
6-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine-2-carbohydrazide (PubChem CID 106909643) has the molecular formula C12H17N7OS and a molecular weight of 307.38 g/mol. Its IUPAC name is 6-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine-2-carbohydrazide.
| Compound Name | 6-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 106909643 |
| Molecular Formula | C12H17N7OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 6-[(5-amino-4-propan-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine-2-carbohydrazide |
| SMILES | CC(C)n1c(N)nnc1SCc1cccc(C(=O)NN)n1 |
| InChI | InChI=1S/C12H17N7OS/c1-7(2)19-11(13)17-18-12(19)21-6-8-4-3-5-9(15-8)10(20)16-14/h3-5,7H,6,14H2,1-2H3,(H2,13,17)(H,16,20) |
| InChIKey | LOIIVCLAJGNWCT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|