C9H10N6OS — CID 106909598
6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)pyridine-2-carbohydrazide (PubChem CID 106909598) has the molecular formula C9H10N6OS and a molecular weight of 250.29 g/mol. Its IUPAC name is 6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)pyridine-2-carbohydrazide.
| Compound Name | 6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 106909598 |
| Molecular Formula | C9H10N6OS |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1cccc(CSc2ncn[nH]2)n1 |
| InChI | InChI=1S/C9H10N6OS/c10-14-8(16)7-3-1-2-6(13-7)4-17-9-11-5-12-15-9/h1-3,5H,4,10H2,(H,14,16)(H,11,12,15) |
| InChIKey | NZVVJLYUFMSJQC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|