C12H13N5OS — CID 106909676
6-[(5-amino-2-pyridinyl)sulfanylmethyl]pyridine-2-carbohydrazide (PubChem CID 106909676) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 6-[(5-amino-2-pyridinyl)sulfanylmethyl]pyridine-2-carbohydrazide.
| Compound Name | 6-[(5-amino-2-pyridinyl)sulfanylmethyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 106909676 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 6-[(5-amino-2-pyridinyl)sulfanylmethyl]pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1cccc(CSc2ccc(N)cn2)n1 |
| InChI | InChI=1S/C12H13N5OS/c13-8-4-5-11(15-6-8)19-7-9-2-1-3-10(16-9)12(18)17-14/h1-6H,7,13-14H2,(H,17,18) |
| InChIKey | DVNIEAAODPKVIV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|