C9H14N4OS — CID 63590276
3-[(5-amino-2-pyridinyl)sulfanyl]-2-methylpropanehydrazide (PubChem CID 63590276) has the molecular formula C9H14N4OS and a molecular weight of 226.31 g/mol. Its IUPAC name is 3-[(5-amino-2-pyridinyl)sulfanyl]-2-methylpropanehydrazide.
| Compound Name | 3-[(5-amino-2-pyridinyl)sulfanyl]-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 63590276 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-[(5-amino-2-pyridinyl)sulfanyl]-2-methylpropanehydrazide |
| SMILES | CC(CSc1ccc(N)cn1)C(=O)NN |
| InChI | InChI=1S/C9H14N4OS/c1-6(9(14)13-11)5-15-8-3-2-7(10)4-12-8/h2-4,6H,5,10-11H2,1H3,(H,13,14) |
| InChIKey | LRFVYUCNJMHIRO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|