C11H13N5OS2 — CID 64560562
3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-phenylpropanehydrazide (PubChem CID 64560562) has the molecular formula C11H13N5OS2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-phenylpropanehydrazide.
| Compound Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-phenylpropanehydrazide |
|---|---|
| PubChem CID | 64560562 |
| Molecular Formula | C11H13N5OS2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-phenylpropanehydrazide |
| SMILES | NNC(=O)C(CSc1nnc(N)s1)c1ccccc1 |
| InChI | InChI=1S/C11H13N5OS2/c12-10-15-16-11(19-10)18-6-8(9(17)14-13)7-4-2-1-3-5-7/h1-5,8H,6,13H2,(H2,12,15)(H,14,17) |
| InChIKey | VDEKAPVHHZKYJW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|