C12H17N3O2S — CID 114232081
2-(3-hydrazinyl-3-oxo-2-phenylpropyl)sulfanyl-N-methylacetamide (PubChem CID 114232081) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-(3-hydrazinyl-3-oxo-2-phenylpropyl)sulfanyl-N-methylacetamide.
| Compound Name | 2-(3-hydrazinyl-3-oxo-2-phenylpropyl)sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 114232081 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(3-hydrazinyl-3-oxo-2-phenylpropyl)sulfanyl-N-methylacetamide |
| SMILES | CNC(=O)CSCC(C(=O)NN)c1ccccc1 |
| InChI | InChI=1S/C12H17N3O2S/c1-14-11(16)8-18-7-10(12(17)15-13)9-5-3-2-4-6-9/h2-6,10H,7-8,13H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | CCJCYBSJWPWZSD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|