C19H24ClN5O — CID 24845652
1-[2-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]pyrrolidin-2-one;hydrochloride (PubChem CID 24845652) has the molecular formula C19H24ClN5O and a molecular weight of 373.89 g/mol. Its IUPAC name is 1-[2-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-[2-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 24845652 |
| Molecular Formula | C19H24ClN5O |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[2-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1CCCN1c1ccnc(N2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H23N5O.ClH/c25-18-7-4-10-24(18)17-8-9-20-19(21-17)23-13-11-22(12-14-23)15-16-5-2-1-3-6-16;/h1-3,5-6,8-9H,4,7,10-15H2;1H |
| InChIKey | PVJMBDCLYUCNCC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |