C21H24N6O — CID 117081146
N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 117081146) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 117081146 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | c1ccc(OCCNc2ccnc(N3CCN(c4ccccn4)CC3)n2)cc1 |
| InChI | InChI=1S/C21H24N6O/c1-2-6-18(7-3-1)28-17-12-22-19-9-11-24-21(25-19)27-15-13-26(14-16-27)20-8-4-5-10-23-20/h1-11H,12-17H2,(H,22,24,25) |
| InChIKey | ZPOAYBIODSWKJZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|