C14H15FN4 — CID 112882681
4-N-[(4-fluorophenyl)methyl]-2-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112882681) has the molecular formula C14H15FN4 and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-N-[(4-fluorophenyl)methyl]-2-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(4-fluorophenyl)methyl]-2-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112882681 |
| Molecular Formula | C14H15FN4 |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 4-N-[(4-fluorophenyl)methyl]-2-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1nccc(NCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H15FN4/c1-2-8-16-14-17-9-7-13(19-14)18-10-11-3-5-12(15)6-4-11/h2-7,9H,1,8,10H2,(H2,16,17,18,19) |
| InChIKey | SHPLXBODWCTDIV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|