C31H37N3O3 — CID 18388185
[2-[4-[1-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-yl] benzoate (PubChem CID 18388185) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is [2-[4-[1-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-yl] benzoate.
| Compound Name | [2-[4-[1-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-yl] benzoate |
|---|---|
| PubChem CID | 18388185 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | [2-[4-[1-(dibutylamino)propoxy]phenyl]imidazo[1,2-a]pyridin-8-yl] benzoate |
| SMILES | CCCCN(CCCC)C(CC)Oc1ccc(-c2cn3cccc(OC(=O)c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C31H37N3O3/c1-4-7-20-33(21-8-5-2)29(6-3)36-26-18-16-24(17-19-26)27-23-34-22-12-15-28(30(34)32-27)37-31(35)25-13-10-9-11-14-25/h9-19,22-23,29H,4-8,20-21H2,1-3H3 |
| InChIKey | OLPQUQVPLJHVQJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|