C20H13ClN2O2 — CID 171984006
[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-8-yl] benzoate (PubChem CID 171984006) has the molecular formula C20H13ClN2O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is [2-(4-chlorophenyl)imidazo[1,2-a]pyridin-8-yl] benzoate.
| Compound Name | [2-(4-chlorophenyl)imidazo[1,2-a]pyridin-8-yl] benzoate |
|---|---|
| PubChem CID | 171984006 |
| Molecular Formula | C20H13ClN2O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | [2-(4-chlorophenyl)imidazo[1,2-a]pyridin-8-yl] benzoate |
| SMILES | O=C(Oc1cccn2cc(-c3ccc(Cl)cc3)nc12)c1ccccc1 |
| InChI | InChI=1S/C20H13ClN2O2/c21-16-10-8-14(9-11-16)17-13-23-12-4-7-18(19(23)22-17)25-20(24)15-5-2-1-3-6-15/h1-13H |
| InChIKey | FDEBXINSFRPAIS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |