C14H10FN3O2 — CID 69371614
[2-(3-fluorophenyl)imidazo[1,2-a]pyridin-8-yl] carbamate (PubChem CID 69371614) has the molecular formula C14H10FN3O2 and a molecular weight of 271.25 g/mol. Its IUPAC name is [2-(3-fluorophenyl)imidazo[1,2-a]pyridin-8-yl] carbamate.
| Compound Name | [2-(3-fluorophenyl)imidazo[1,2-a]pyridin-8-yl] carbamate |
|---|---|
| PubChem CID | 69371614 |
| Molecular Formula | C14H10FN3O2 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | [2-(3-fluorophenyl)imidazo[1,2-a]pyridin-8-yl] carbamate |
| SMILES | NC(=O)Oc1cccn2cc(-c3cccc(F)c3)nc12 |
| InChI | InChI=1S/C14H10FN3O2/c15-10-4-1-3-9(7-10)11-8-18-6-2-5-12(13(18)17-11)20-14(16)19/h1-8H,(H2,16,19) |
| InChIKey | CIIFYCVJAQVREA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |