C15H10F3N3O2 — CID 69371327
[2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl] carbamate (PubChem CID 69371327) has the molecular formula C15H10F3N3O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is [2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl] carbamate.
| Compound Name | [2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl] carbamate |
|---|---|
| PubChem CID | 69371327 |
| Molecular Formula | C15H10F3N3O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | [2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl] carbamate |
| SMILES | NC(=O)Oc1cccn2cc(-c3ccc(C(F)(F)F)cc3)nc12 |
| InChI | InChI=1S/C15H10F3N3O2/c16-15(17,18)10-5-3-9(4-6-10)11-8-21-7-1-2-12(13(21)20-11)23-14(19)22/h1-8H,(H2,19,22) |
| InChIKey | HPUUMBDEVJIXOC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |