C26H33ClN2OS — CID 70415710
N-butyl-N-[1-[3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenoxy]propyl]butan-1-amine (PubChem CID 70415710) has the molecular formula C26H33ClN2OS and a molecular weight of 457.08 g/mol. Its IUPAC name is N-butyl-N-[1-[3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenoxy]propyl]butan-1-amine.
| Compound Name | N-butyl-N-[1-[3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenoxy]propyl]butan-1-amine |
|---|---|
| PubChem CID | 70415710 |
| Molecular Formula | C26H33ClN2OS |
| Molecular Weight | 457.08 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-butyl-N-[1-[3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenoxy]propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)C(CC)Oc1cccc(-c2csc(-c3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C26H33ClN2OS/c1-4-7-16-29(17-8-5-2)25(6-3)30-23-11-9-10-21(18-23)24-19-31-26(28-24)20-12-14-22(27)15-13-20/h9-15,18-19,25H,4-8,16-17H2,1-3H3 |
| InChIKey | JZCQDCSHGCTLSN-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.08 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|