C16H10ClF2NOS — CID 2742538
2-(4-chlorophenyl)-4-[3-(difluoromethoxy)phenyl]-1,3-thiazole (PubChem CID 2742538) has the molecular formula C16H10ClF2NOS and a molecular weight of 337.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[3-(difluoromethoxy)phenyl]-1,3-thiazole.
| Compound Name | 2-(4-chlorophenyl)-4-[3-(difluoromethoxy)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 2742538 |
| Molecular Formula | C16H10ClF2NOS |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[3-(difluoromethoxy)phenyl]-1,3-thiazole |
| SMILES | FC(F)Oc1cccc(-c2csc(-c3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C16H10ClF2NOS/c17-12-6-4-10(5-7-12)15-20-14(9-22-15)11-2-1-3-13(8-11)21-16(18)19/h1-9,16H |
| InChIKey | UYDBJJHLWDQYPL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |