C10H7F2NOS — CID 91278052
4-(difluoromethoxy)-2-phenyl-1,3-thiazole (PubChem CID 91278052) has the molecular formula C10H7F2NOS and a molecular weight of 227.24 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2-phenyl-1,3-thiazole.
| Compound Name | 4-(difluoromethoxy)-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 91278052 |
| Molecular Formula | C10H7F2NOS |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 4-(difluoromethoxy)-2-phenyl-1,3-thiazole |
| SMILES | FC(F)Oc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H7F2NOS/c11-10(12)14-8-6-15-9(13-8)7-4-2-1-3-5-7/h1-6,10H |
| InChIKey | MPCOTTDQKDLDIY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |