C23H27N3O2S — CID 108748714
2-ethylhexyl N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]carbamate (PubChem CID 108748714) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-ethylhexyl N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]carbamate.
| Compound Name | 2-ethylhexyl N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 108748714 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-ethylhexyl N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]carbamate |
| SMILES | CCCCC(CC)COC(=O)Nc1cccc(-c2csc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C23H27N3O2S/c1-3-5-7-17(4-2)15-28-23(27)25-20-9-6-8-19(14-20)21-16-29-22(26-21)18-10-12-24-13-11-18/h6,8-14,16-17H,3-5,7,15H2,1-2H3,(H,25,27) |
| InChIKey | UIPSFRAMLONIFX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |