C22H15Cl2NOS — CID 4031287
4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-phenyl-1,3-thiazole (PubChem CID 4031287) has the molecular formula C22H15Cl2NOS and a molecular weight of 412.34 g/mol. Its IUPAC name is 4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-phenyl-1,3-thiazole.
| Compound Name | 4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 4031287 |
| Molecular Formula | C22H15Cl2NOS |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-phenyl-1,3-thiazole |
| SMILES | Clc1ccc(COc2ccc(-c3csc(-c4ccccc4)n3)cc2)cc1Cl |
| InChI | InChI=1S/C22H15Cl2NOS/c23-19-11-6-15(12-20(19)24)13-26-18-9-7-16(8-10-18)21-14-27-22(25-21)17-4-2-1-3-5-17/h1-12,14H,13H2 |
| InChIKey | DBLKCDKVPWCKJK-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |