C26H23Cl2N3O2S — CID 142249306
4-[[1-aminoethyl-[4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1,3-thiazol-2-yl]amino]methyl]benzaldehyde (PubChem CID 142249306) has the molecular formula C26H23Cl2N3O2S and a molecular weight of 512.46 g/mol. Its IUPAC name is 4-[[1-aminoethyl-[4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1,3-thiazol-2-yl]amino]methyl]benzaldehyde.
| Compound Name | 4-[[1-aminoethyl-[4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1,3-thiazol-2-yl]amino]methyl]benzaldehyde |
|---|---|
| PubChem CID | 142249306 |
| Molecular Formula | C26H23Cl2N3O2S |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 4-[[1-aminoethyl-[4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1,3-thiazol-2-yl]amino]methyl]benzaldehyde |
| SMILES | CC(N)N(Cc1ccc(C=O)cc1)c1nc(-c2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)cs1 |
| InChI | InChI=1S/C26H23Cl2N3O2S/c1-17(29)31(13-18-2-4-19(14-32)5-3-18)26-30-25(16-34-26)21-7-9-22(10-8-21)33-15-20-6-11-23(27)24(28)12-20/h2-12,14,16-17H,13,15,29H2,1H3 |
| InChIKey | FGJIDEAZJKUBLA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|